C13H14ClF2NO2 — CID 122159233
2-chloro-4,5-difluoro-N-(3-methyloxan-3-yl)benzamide (PubChem CID 122159233) has the molecular formula C13H14ClF2NO2 and a molecular weight of 289.71 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(3-methyloxan-3-yl)benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-(3-methyloxan-3-yl)benzamide |
|---|---|
| PubChem CID | 122159233 |
| Molecular Formula | C13H14ClF2NO2 |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(3-methyloxan-3-yl)benzamide |
| SMILES | CC1(NC(=O)c2cc(F)c(F)cc2Cl)CCCOC1 |
| InChI | InChI=1S/C13H14ClF2NO2/c1-13(3-2-4-19-7-13)17-12(18)8-5-10(15)11(16)6-9(8)14/h5-6H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | RACJSCYTJLTBAD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|