C12H14ClNO3 — CID 106502165
2-chloro-5-hydroxy-N-(3-methyloxolan-3-yl)benzamide (PubChem CID 106502165) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N-(3-methyloxolan-3-yl)benzamide.
| Compound Name | 2-chloro-5-hydroxy-N-(3-methyloxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 106502165 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-chloro-5-hydroxy-N-(3-methyloxolan-3-yl)benzamide |
| SMILES | CC1(NC(=O)c2cc(O)ccc2Cl)CCOC1 |
| InChI | InChI=1S/C12H14ClNO3/c1-12(4-5-17-7-12)14-11(16)9-6-8(15)2-3-10(9)13/h2-3,6,15H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | QFXGXZLYBLSJCC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |