C12H13Br2NO2 — CID 114372910
2,5-dibromo-N-(3-methyloxolan-3-yl)benzamide (PubChem CID 114372910) has the molecular formula C12H13Br2NO2 and a molecular weight of 363.05 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-methyloxolan-3-yl)benzamide.
| Compound Name | 2,5-dibromo-N-(3-methyloxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 114372910 |
| Molecular Formula | C12H13Br2NO2 |
| Molecular Weight | 363.05 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 2,5-dibromo-N-(3-methyloxolan-3-yl)benzamide |
| SMILES | CC1(NC(=O)c2cc(Br)ccc2Br)CCOC1 |
| InChI | InChI=1S/C12H13Br2NO2/c1-12(4-5-17-7-12)15-11(16)9-6-8(13)2-3-10(9)14/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | DKTLRNMLGKVORR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |