C13H13BrF3NO2 — CID 115769176
4-bromo-N-(3-methyloxolan-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 115769176) has the molecular formula C13H13BrF3NO2 and a molecular weight of 352.15 g/mol. Its IUPAC name is 4-bromo-N-(3-methyloxolan-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(3-methyloxolan-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115769176 |
| Molecular Formula | C13H13BrF3NO2 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-bromo-N-(3-methyloxolan-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CC1(NC(=O)c2ccc(Br)c(C(F)(F)F)c2)CCOC1 |
| InChI | InChI=1S/C13H13BrF3NO2/c1-12(4-5-20-7-12)18-11(19)8-2-3-10(14)9(6-8)13(15,16)17/h2-3,6H,4-5,7H2,1H3,(H,18,19) |
| InChIKey | QSYPWDFQFCMBLF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |