C12H9BrF3NO — CID 115866905
4-bromo-N-but-2-ynyl-3-(trifluoromethyl)benzamide (PubChem CID 115866905) has the molecular formula C12H9BrF3NO and a molecular weight of 320.11 g/mol. Its IUPAC name is 4-bromo-N-but-2-ynyl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-but-2-ynyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115866905 |
| Molecular Formula | C12H9BrF3NO |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 4-bromo-N-but-2-ynyl-3-(trifluoromethyl)benzamide |
| SMILES | CC#CCNC(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9BrF3NO/c1-2-3-6-17-11(18)8-4-5-10(13)9(7-8)12(14,15)16/h4-5,7H,6H2,1H3,(H,17,18) |
| InChIKey | LQHNUZZJNHINKZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|