C12H12Br2F3NO — CID 106845802
4-bromo-N-(4-bromobutyl)-3-(trifluoromethyl)benzamide (PubChem CID 106845802) has the molecular formula C12H12Br2F3NO and a molecular weight of 403.04 g/mol. Its IUPAC name is 4-bromo-N-(4-bromobutyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(4-bromobutyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 106845802 |
| Molecular Formula | C12H12Br2F3NO |
| Molecular Weight | 403.04 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 4-bromo-N-(4-bromobutyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCBr)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12Br2F3NO/c13-5-1-2-6-18-11(19)8-3-4-10(14)9(7-8)12(15,16)17/h3-4,7H,1-2,5-6H2,(H,18,19) |
| InChIKey | RQRBPOHZERRSIU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.04 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|