C12H13BrF3NO2 — CID 81433232
4-bromo-N-(2-ethoxyethyl)-3-(trifluoromethyl)benzamide (PubChem CID 81433232) has the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. Its IUPAC name is 4-bromo-N-(2-ethoxyethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(2-ethoxyethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 81433232 |
| Molecular Formula | C12H13BrF3NO2 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-bromo-N-(2-ethoxyethyl)-3-(trifluoromethyl)benzamide |
| SMILES | CCOCCNC(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13BrF3NO2/c1-2-19-6-5-17-11(18)8-3-4-10(13)9(7-8)12(14,15)16/h3-4,7H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | RXOXTEWXRWUMNP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|