C14H16Br2F3NO — CID 114315241
4-bromo-N-[3-(bromomethyl)pentan-3-yl]-3-(trifluoromethyl)benzamide (PubChem CID 114315241) has the molecular formula C14H16Br2F3NO and a molecular weight of 431.09 g/mol. Its IUPAC name is 4-bromo-N-[3-(bromomethyl)pentan-3-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-[3-(bromomethyl)pentan-3-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114315241 |
| Molecular Formula | C14H16Br2F3NO |
| Molecular Weight | 431.09 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | 4-bromo-N-[3-(bromomethyl)pentan-3-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCC(CC)(CBr)NC(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16Br2F3NO/c1-3-13(4-2,8-15)20-12(21)9-5-6-11(16)10(7-9)14(17,18)19/h5-7H,3-4,8H2,1-2H3,(H,20,21) |
| InChIKey | YNGYLTPJWLEMBL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.09 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|