C13H12Cl2FNO3 — CID 79848631
2-[1-[(2,4-dichloro-5-fluorobenzoyl)amino]cyclobutyl]acetic acid (PubChem CID 79848631) has the molecular formula C13H12Cl2FNO3 and a molecular weight of 320.15 g/mol. Its IUPAC name is 2-[1-[(2,4-dichloro-5-fluorobenzoyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(2,4-dichloro-5-fluorobenzoyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 79848631 |
| Molecular Formula | C13H12Cl2FNO3 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-[1-[(2,4-dichloro-5-fluorobenzoyl)amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cc(F)c(Cl)cc2Cl)CCC1 |
| InChI | InChI=1S/C13H12Cl2FNO3/c14-8-5-9(15)10(16)4-7(8)12(20)17-13(2-1-3-13)6-11(18)19/h4-5H,1-3,6H2,(H,17,20)(H,18,19) |
| InChIKey | XUGOZAREBXSRPT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|