C12H12ClFN2O3 — CID 114037013
2-[1-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]cyclobutyl]acetic acid (PubChem CID 114037013) has the molecular formula C12H12ClFN2O3 and a molecular weight of 286.69 g/mol. Its IUPAC name is 2-[1-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 114037013 |
| Molecular Formula | C12H12ClFN2O3 |
| Molecular Weight | 286.69 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[1-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cc(F)cnc2Cl)CCC1 |
| InChI | InChI=1S/C12H12ClFN2O3/c13-10-8(4-7(14)6-15-10)11(19)16-12(2-1-3-12)5-9(17)18/h4,6H,1-3,5H2,(H,16,19)(H,17,18) |
| InChIKey | NXQZLIHOZAJRKK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|