C14H19ClFN3O — CID 103940090
2-chloro-N-[[1-(dimethylamino)cyclopentyl]methyl]-5-fluoropyridine-3-carboxamide (PubChem CID 103940090) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 2-chloro-N-[[1-(dimethylamino)cyclopentyl]methyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[1-(dimethylamino)cyclopentyl]methyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103940090 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-chloro-N-[[1-(dimethylamino)cyclopentyl]methyl]-5-fluoropyridine-3-carboxamide |
| SMILES | CN(C)C1(CNC(=O)c2cc(F)cnc2Cl)CCCC1 |
| InChI | InChI=1S/C14H19ClFN3O/c1-19(2)14(5-3-4-6-14)9-18-13(20)11-7-10(16)8-17-12(11)15/h7-8H,3-6,9H2,1-2H3,(H,18,20) |
| InChIKey | KZAMOECIARAHQU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|