C12H17ClFN3O2 — CID 103940270
2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-fluoropyridine-3-carboxamide (PubChem CID 103940270) has the molecular formula C12H17ClFN3O2 and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103940270 |
| Molecular Formula | C12H17ClFN3O2 |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-fluoropyridine-3-carboxamide |
| SMILES | CN(C)CC(C)(O)CNC(=O)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C12H17ClFN3O2/c1-12(19,7-17(2)3)6-16-11(18)9-4-8(14)5-15-10(9)13/h4-5,19H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | MQZGQULQAVCXPO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|