C13H17ClFN3O — CID 114034209
2-chloro-5-fluoro-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide (PubChem CID 114034209) has the molecular formula C13H17ClFN3O and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-fluoro-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114034209 |
| Molecular Formula | C13H17ClFN3O |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-chloro-5-fluoro-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide |
| SMILES | CN1CCC(CNC(=O)c2cc(F)cnc2Cl)CC1 |
| InChI | InChI=1S/C13H17ClFN3O/c1-18-4-2-9(3-5-18)7-17-13(19)11-6-10(15)8-16-12(11)14/h6,8-9H,2-5,7H2,1H3,(H,17,19) |
| InChIKey | VCNABAZHDABPCN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|