C18H25ClFN3O3 — CID 142991989
tert-butyl N-[4-[[(2-chloro-5-fluoropyridine-3-carbonyl)amino]methyl]cyclohexyl]carbamate (PubChem CID 142991989) has the molecular formula C18H25ClFN3O3 and a molecular weight of 385.87 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2-chloro-5-fluoropyridine-3-carbonyl)amino]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2-chloro-5-fluoropyridine-3-carbonyl)amino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 142991989 |
| Molecular Formula | C18H25ClFN3O3 |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl N-[4-[[(2-chloro-5-fluoropyridine-3-carbonyl)amino]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CNC(=O)c2cc(F)cnc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClFN3O3/c1-18(2,3)26-17(25)23-13-6-4-11(5-7-13)9-22-16(24)14-8-12(20)10-21-15(14)19/h8,10-11,13H,4-7,9H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | CGVPJPMHOKGYGJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|