About tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane
tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane (PubChem CID 145414377) has the molecular formula C22H41FN4O2
and a molecular weight of 412.59 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane |
| PubChem CID | 145414377 |
| Molecular Formula | C22H41FN4O2 |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane |
| SMILES | CC.CC.CCNc1ncc(F)cc1NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H29FN4O2.2C2H6/c1-5-20-16-15(10-12(19)11-21-16)22-13-6-8-14(9-7-13)23-17(24)25-18(2,3)4;2*1-2/h10-11,13-14,22H,5-9H2,1-4H3,(H,20,21)(H,23,24);2*1-2H3 |
| InChIKey | IEECITFQXGNJAB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane?
The IUPAC name of tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane (CID 145414377) is tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane?
The canonical SMILES for tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane is CC.CC.CCNc1ncc(F)cc1NC1CCC(NC(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane?
The InChIKey is IEECITFQXGNJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FN4O2.2C2H6/c1-5-20-16-15(10-12(19)11-21-16)22-13-6-8-14(9-7-13)23-17(24)25-18(2,3)4;2*1-2/h10-11,13-14,22H,5-9H2,1-4H3,(H,20,21)(H,23,24);2*1-2H3.
What are the key properties of tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane?
tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane has a molecular weight of 412.59 g/mol, XLogP of 5.95, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-[[2-(ethylamino)-5-fluoro-3-pyridinyl]amino]cyclohexyl]carbamate;ethane is sourced from PubChem (CID 145414377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).