C9H10ClFN2O — CID 103891263
2-chloro-5-fluoro-N-propan-2-ylpyridine-3-carboxamide (PubChem CID 103891263) has the molecular formula C9H10ClFN2O and a molecular weight of 216.64 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-propan-2-ylpyridine-3-carboxamide.
| Compound Name | 2-chloro-5-fluoro-N-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 103891263 |
| Molecular Formula | C9H10ClFN2O |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-chloro-5-fluoro-N-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)NC(=O)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C9H10ClFN2O/c1-5(2)13-9(14)7-3-6(11)4-12-8(7)10/h3-5H,1-2H3,(H,13,14) |
| InChIKey | XJYVRBGTTMFQKA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|