C12H16ClFN2O — CID 103892511
2-chloro-N-(3,3-dimethylbutan-2-yl)-5-fluoropyridine-3-carboxamide (PubChem CID 103892511) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is 2-chloro-N-(3,3-dimethylbutan-2-yl)-5-fluoropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(3,3-dimethylbutan-2-yl)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103892511 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-chloro-N-(3,3-dimethylbutan-2-yl)-5-fluoropyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(F)cnc1Cl)C(C)(C)C |
| InChI | InChI=1S/C12H16ClFN2O/c1-7(12(2,3)4)16-11(17)9-5-8(14)6-15-10(9)13/h5-7H,1-4H3,(H,16,17) |
| InChIKey | ZGCHXWKKPCYVQB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|