C16H16ClFN2O — CID 87757101
N-(4-tert-butylphenyl)-2-chloro-5-fluoropyridine-3-carboxamide (PubChem CID 87757101) has the molecular formula C16H16ClFN2O and a molecular weight of 306.77 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-chloro-5-fluoropyridine-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-2-chloro-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 87757101 |
| Molecular Formula | C16H16ClFN2O |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-chloro-5-fluoropyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cc(F)cnc2Cl)cc1 |
| InChI | InChI=1S/C16H16ClFN2O/c1-16(2,3)10-4-6-12(7-5-10)20-15(21)13-8-11(18)9-19-14(13)17/h4-9H,1-3H3,(H,20,21) |
| InChIKey | TUIMHAITDZQQLU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|