C14H12ClFN2O — CID 103891458
2-chloro-N-(4-ethylphenyl)-5-fluoropyridine-3-carboxamide (PubChem CID 103891458) has the molecular formula C14H12ClFN2O and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-chloro-N-(4-ethylphenyl)-5-fluoropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4-ethylphenyl)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103891458 |
| Molecular Formula | C14H12ClFN2O |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-N-(4-ethylphenyl)-5-fluoropyridine-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cc(F)cnc2Cl)cc1 |
| InChI | InChI=1S/C14H12ClFN2O/c1-2-9-3-5-11(6-4-9)18-14(19)12-7-10(16)8-17-13(12)15/h3-8H,2H2,1H3,(H,18,19) |
| InChIKey | XPNYRASZVSROED-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|