C12H14ClFN2O3 — CID 114036625
(2R)-2-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 114036625) has the molecular formula C12H14ClFN2O3 and a molecular weight of 288.71 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 114036625 |
| Molecular Formula | C12H14ClFN2O3 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (2R)-2-[(2-chloro-5-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1cc(F)cnc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14ClFN2O3/c1-6(2)3-9(12(18)19)16-11(17)8-4-7(14)5-15-10(8)13/h4-6,9H,3H2,1-2H3,(H,16,17)(H,18,19)/t9-/m1/s1 |
| InChIKey | LDZAKFVNTHFMCM-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|