C12H16ClNO2 — CID 114303305
N-[1-(chloromethyl)cyclohexyl]furan-3-carboxamide (PubChem CID 114303305) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclohexyl]furan-3-carboxamide.
| Compound Name | N-[1-(chloromethyl)cyclohexyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 114303305 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[1-(chloromethyl)cyclohexyl]furan-3-carboxamide |
| SMILES | O=C(NC1(CCl)CCCCC1)c1ccoc1 |
| InChI | InChI=1S/C12H16ClNO2/c13-9-12(5-2-1-3-6-12)14-11(15)10-4-7-16-8-10/h4,7-8H,1-3,5-6,9H2,(H,14,15) |
| InChIKey | YBSIQLISAQBNFT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|