C14H15F3O3 — CID 150977952
4-[(3,3-difluorocyclohexyl)methoxy]-2-fluorobenzoic acid (PubChem CID 150977952) has the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclohexyl)methoxy]-2-fluorobenzoic acid.
| Compound Name | 4-[(3,3-difluorocyclohexyl)methoxy]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 150977952 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-[(3,3-difluorocyclohexyl)methoxy]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(OCC2CCCC(F)(F)C2)cc1F |
| InChI | InChI=1S/C14H15F3O3/c15-12-6-10(3-4-11(12)13(18)19)20-8-9-2-1-5-14(16,17)7-9/h3-4,6,9H,1-2,5,7-8H2,(H,18,19) |
| InChIKey | LPMHHEALNKXQOH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |