C13H13ClF2O3 — CID 114224112
3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid (PubChem CID 114224112) has the molecular formula C13H13ClF2O3 and a molecular weight of 290.69 g/mol. Its IUPAC name is 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid.
| Compound Name | 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 114224112 |
| Molecular Formula | C13H13ClF2O3 |
| Molecular Weight | 290.69 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1OCC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H13ClF2O3/c14-10-3-1-2-9(12(17)18)11(10)19-7-8-4-5-13(15,16)6-8/h1-3,8H,4-7H2,(H,17,18) |
| InChIKey | OKPAODINPYJGEB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |