3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid

C13H13ClF2O3 — CID 114224112

IUPAC3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid
SMILESO=C(O)c1cccc(Cl)c1OCC1CCC(F)(F)C1
InChIInChI=1S/C13H13ClF2O3/c14-10-3-1-2-9(12(17)18)11(10)19-7-8-4-5-13(15,16)6-8/h1-3,8H,4-7H2,(H,17,18)
InChIKeyOKPAODINPYJGEB-UHFFFAOYSA-N
MW290.69 g/mol
LogP3.85
Rot. Bonds4

About 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid

3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid (PubChem CID 114224112) has the molecular formula C13H13ClF2O3 and a molecular weight of 290.69 g/mol. Its IUPAC name is 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid.

Molecular Properties

Compound Name3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid
PubChem CID114224112
Molecular FormulaC13H13ClF2O3
Molecular Weight290.69 g/mol
Exact Mass290.05
IUPAC Name3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid
SMILESO=C(O)c1cccc(Cl)c1OCC1CCC(F)(F)C1
InChIInChI=1S/C13H13ClF2O3/c14-10-3-1-2-9(12(17)18)11(10)19-7-8-4-5-13(15,16)6-8/h1-3,8H,4-7H2,(H,17,18)
InChIKeyOKPAODINPYJGEB-UHFFFAOYSA-N
XLogP3.85
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.69
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid?
The IUPAC name of 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid (CID 114224112) is 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid.
What is the SMILES notation for 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid?
The canonical SMILES for 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid is O=C(O)c1cccc(Cl)c1OCC1CCC(F)(F)C1.
What is the InChIKey of 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid?
The InChIKey is OKPAODINPYJGEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClF2O3/c14-10-3-1-2-9(12(17)18)11(10)19-7-8-4-5-13(15,16)6-8/h1-3,8H,4-7H2,(H,17,18).
What are the key properties of 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid?
3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid has a molecular weight of 290.69 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzoic acid is sourced from PubChem (CID 114224112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).