C13H13ClF2O2 — CID 114224106
3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzaldehyde (PubChem CID 114224106) has the molecular formula C13H13ClF2O2 and a molecular weight of 274.69 g/mol. Its IUPAC name is 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzaldehyde.
| Compound Name | 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 114224106 |
| Molecular Formula | C13H13ClF2O2 |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-chloro-2-[(3,3-difluorocyclopentyl)methoxy]benzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1OCC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H13ClF2O2/c14-11-3-1-2-10(7-17)12(11)18-8-9-4-5-13(15,16)6-9/h1-3,7,9H,4-6,8H2 |
| InChIKey | JQGDQADOXXFFFL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|