C17H15ClO3 — CID 115955703
3-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzaldehyde (PubChem CID 115955703) has the molecular formula C17H15ClO3 and a molecular weight of 302.76 g/mol. Its IUPAC name is 3-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzaldehyde.
| Compound Name | 3-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 115955703 |
| Molecular Formula | C17H15ClO3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1OCC1OCCc2ccccc21 |
| InChI | InChI=1S/C17H15ClO3/c18-15-7-3-5-13(10-19)17(15)21-11-16-14-6-2-1-4-12(14)8-9-20-16/h1-7,10,16H,8-9,11H2 |
| InChIKey | FKMKHURFZMHJAK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|