C10H12OS — CID 129369937
[(1R)-3,4-dihydro-1H-isochromen-1-yl]methanethiol (PubChem CID 129369937) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is [(1R)-3,4-dihydro-1H-isochromen-1-yl]methanethiol.
| Compound Name | [(1R)-3,4-dihydro-1H-isochromen-1-yl]methanethiol |
|---|---|
| PubChem CID | 129369937 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | [(1R)-3,4-dihydro-1H-isochromen-1-yl]methanethiol |
| SMILES | SC[C@@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C10H12OS/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-4,10,12H,5-7H2/t10-/m0/s1 |
| InChIKey | JGJPHYWSLJHCDL-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|