C25H27NO — CID 138551050
N,N-dibenzyl-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethanamine (PubChem CID 138551050) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is N,N-dibenzyl-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethanamine.
| Compound Name | N,N-dibenzyl-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethanamine |
|---|---|
| PubChem CID | 138551050 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N,N-dibenzyl-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethanamine |
| SMILES | c1ccc(CN(CC[C@@H]2OCCc3ccccc32)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO/c1-3-9-21(10-4-1)19-26(20-22-11-5-2-6-12-22)17-15-25-24-14-8-7-13-23(24)16-18-27-25/h1-14,25H,15-20H2/t25-/m0/s1 |
| InChIKey | IZJJAVJNDKPDAZ-VWLOTQADSA-N |
| XLogP | 5.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |