About 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine
2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine (PubChem CID 14141276) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine.
Analyze 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine?
The IUPAC name of 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine (CID 14141276) is 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine.
What is the SMILES notation for 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine?
The canonical SMILES for 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine is CNCCC1OCCc2ccccc21.
What is the InChIKey of 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine?
The InChIKey is SWJHIGGHHUJWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-13-8-6-12-11-5-3-2-4-10(11)7-9-14-12/h2-5,12-13H,6-9H2,1H3.
What are the key properties of 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine?
2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine has a molecular weight of 191.27 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine is sourced from PubChem (CID 14141276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).