C17H17NO2 — CID 755342
4-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]phenol (PubChem CID 755342) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]phenol.
| Compound Name | 4-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 755342 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]phenol |
| SMILES | Oc1ccc(/C=N/C[C@H]2OCCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO2/c19-15-7-5-13(6-8-15)11-18-12-17-16-4-2-1-3-14(16)9-10-20-17/h1-8,11,17,19H,9-10,12H2/b18-11+/t17-/m1/s1 |
| InChIKey | OOUZVIROZSTRII-AUUUKSDWSA-N |
| XLogP | 3.13 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|