C17H17NO3 — CID 911185
5-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]benzene-1,3-diol (PubChem CID 911185) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]benzene-1,3-diol.
| Compound Name | 5-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 911185 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyliminomethyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(/C=N/C[C@H]2OCCc3ccccc32)c1 |
| InChI | InChI=1S/C17H17NO3/c19-14-7-12(8-15(20)9-14)10-18-11-17-16-4-2-1-3-13(16)5-6-21-17/h1-4,7-10,17,19-20H,5-6,11H2/b18-10+/t17-/m1/s1 |
| InChIKey | WQYFSISKCGGDKA-HJSBDDGSSA-N |
| XLogP | 2.83 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|