C17H14ClNO2 — CID 80710481
4-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzonitrile (PubChem CID 80710481) has the molecular formula C17H14ClNO2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzonitrile.
| Compound Name | 4-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 80710481 |
| Molecular Formula | C17H14ClNO2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-chloro-2-(3,4-dihydro-1H-isochromen-1-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1OCC1OCCc2ccccc21 |
| InChI | InChI=1S/C17H14ClNO2/c18-14-6-5-13(10-19)16(9-14)21-11-17-15-4-2-1-3-12(15)7-8-20-17/h1-6,9,17H,7-8,11H2 |
| InChIKey | PECLGNJLIAFBLH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |