About 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene
3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 45268104) has the molecular formula C16H15ClO
and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene |
| PubChem CID | 45268104 |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Clc1ccc(CC2COc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H15ClO/c17-15-7-5-12(6-8-15)9-13-10-14-3-1-2-4-16(14)18-11-13/h1-8,13H,9-11H2 |
| InChIKey | BYUURPKRYNXTPT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene?
The IUPAC name of 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene (CID 45268104) is 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene?
The canonical SMILES for 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene is Clc1ccc(CC2COc3ccccc3C2)cc1.
What is the InChIKey of 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene?
The InChIKey is BYUURPKRYNXTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO/c17-15-7-5-12(6-8-15)9-13-10-14-3-1-2-4-16(14)18-11-13/h1-8,13H,9-11H2.
What are the key properties of 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene?
3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene has a molecular weight of 258.75 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 45268104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).