About 3-phenyl-2H-chromene
3-phenyl-2H-chromene (PubChem CID 500460) has the molecular formula C15H12O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-phenyl-2H-chromene.
Molecular Properties
| Compound Name | 3-phenyl-2H-chromene |
| PubChem CID | 500460 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-phenyl-2H-chromene |
| SMILES | C1=C(c2ccccc2)COc2ccccc21 |
| InChI | InChI=1S/C15H12O/c1-2-6-12(7-3-1)14-10-13-8-4-5-9-15(13)16-11-14/h1-10H,11H2 |
| InChIKey | CNNBJLXLTIKXGJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2H-chromene?
The IUPAC name of 3-phenyl-2H-chromene (CID 500460) is 3-phenyl-2H-chromene.
What is the SMILES notation for 3-phenyl-2H-chromene?
The canonical SMILES for 3-phenyl-2H-chromene is C1=C(c2ccccc2)COc2ccccc21.
What is the InChIKey of 3-phenyl-2H-chromene?
The InChIKey is CNNBJLXLTIKXGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O/c1-2-6-12(7-3-1)14-10-13-8-4-5-9-15(13)16-11-14/h1-10H,11H2.
What are the key properties of 3-phenyl-2H-chromene?
3-phenyl-2H-chromene has a molecular weight of 208.26 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2H-chromene is sourced from PubChem (CID 500460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).