C11H10ClNO5 — CID 112612064
3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid (PubChem CID 112612064) has the molecular formula C11H10ClNO5 and a molecular weight of 271.66 g/mol. Its IUPAC name is 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid.
| Compound Name | 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 112612064 |
| Molecular Formula | C11H10ClNO5 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid |
| SMILES | O=C1NCC(COc2c(Cl)cccc2C(=O)O)O1 |
| InChI | InChI=1S/C11H10ClNO5/c12-8-3-1-2-7(10(14)15)9(8)17-5-6-4-13-11(16)18-6/h1-3,6H,4-5H2,(H,13,16)(H,14,15) |
| InChIKey | UGVHIWLCKUHXQJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |