3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid

C11H10ClNO5 — CID 112612064

IUPAC3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid
SMILESO=C1NCC(COc2c(Cl)cccc2C(=O)O)O1
InChIInChI=1S/C11H10ClNO5/c12-8-3-1-2-7(10(14)15)9(8)17-5-6-4-13-11(16)18-6/h1-3,6H,4-5H2,(H,13,16)(H,14,15)
InChIKeyUGVHIWLCKUHXQJ-UHFFFAOYSA-N
MW271.66 g/mol
LogP1.53
Rot. Bonds4

About 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid

3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid (PubChem CID 112612064) has the molecular formula C11H10ClNO5 and a molecular weight of 271.66 g/mol. Its IUPAC name is 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid.

Molecular Properties

Compound Name3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid
PubChem CID112612064
Molecular FormulaC11H10ClNO5
Molecular Weight271.66 g/mol
Exact Mass271.02
IUPAC Name3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid
SMILESO=C1NCC(COc2c(Cl)cccc2C(=O)O)O1
InChIInChI=1S/C11H10ClNO5/c12-8-3-1-2-7(10(14)15)9(8)17-5-6-4-13-11(16)18-6/h1-3,6H,4-5H2,(H,13,16)(H,14,15)
InChIKeyUGVHIWLCKUHXQJ-UHFFFAOYSA-N
XLogP1.53
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.66
LogP ≤ 51.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid?
The IUPAC name of 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid (CID 112612064) is 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid.
What is the SMILES notation for 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid?
The canonical SMILES for 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid is O=C1NCC(COc2c(Cl)cccc2C(=O)O)O1.
What is the InChIKey of 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid?
The InChIKey is UGVHIWLCKUHXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO5/c12-8-3-1-2-7(10(14)15)9(8)17-5-6-4-13-11(16)18-6/h1-3,6H,4-5H2,(H,13,16)(H,14,15).
What are the key properties of 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid?
3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid has a molecular weight of 271.66 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzoic acid is sourced from PubChem (CID 112612064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).