C11H14N2O — CID 116613726
1-(3-amino-2-pyridinyl)-2-cyclobutylethanone (PubChem CID 116613726) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(3-amino-2-pyridinyl)-2-cyclobutylethanone.
| Compound Name | 1-(3-amino-2-pyridinyl)-2-cyclobutylethanone |
|---|---|
| PubChem CID | 116613726 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(3-amino-2-pyridinyl)-2-cyclobutylethanone |
| SMILES | Nc1cccnc1C(=O)CC1CCC1 |
| InChI | InChI=1S/C11H14N2O/c12-9-5-2-6-13-11(9)10(14)7-8-3-1-4-8/h2,5-6,8H,1,3-4,7,12H2 |
| InChIKey | MPUYIVFPZNIHNC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |