C12H16N2O2 — CID 106202957
2-cyclobutylethyl 3-aminopyridine-2-carboxylate (PubChem CID 106202957) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-cyclobutylethyl 3-aminopyridine-2-carboxylate.
| Compound Name | 2-cyclobutylethyl 3-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 106202957 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-cyclobutylethyl 3-aminopyridine-2-carboxylate |
| SMILES | Nc1cccnc1C(=O)OCCC1CCC1 |
| InChI | InChI=1S/C12H16N2O2/c13-10-5-2-7-14-11(10)12(15)16-8-6-9-3-1-4-9/h2,5,7,9H,1,3-4,6,8,13H2 |
| InChIKey | KPUYHZGCPDHMBY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |