C13H18N2O2 — CID 113447858
(2-methylcyclohexyl) 3-aminopyridine-2-carboxylate (PubChem CID 113447858) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2-methylcyclohexyl) 3-aminopyridine-2-carboxylate.
| Compound Name | (2-methylcyclohexyl) 3-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 113447858 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2-methylcyclohexyl) 3-aminopyridine-2-carboxylate |
| SMILES | CC1CCCCC1OC(=O)c1ncccc1N |
| InChI | InChI=1S/C13H18N2O2/c1-9-5-2-3-7-11(9)17-13(16)12-10(14)6-4-8-15-12/h4,6,8-9,11H,2-3,5,7,14H2,1H3 |
| InChIKey | LSGBFLHIYOZMGK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |