C14H19NO2 — CID 15055566
(2-methylcyclohexyl) 2-pyridin-2-ylacetate (PubChem CID 15055566) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2-methylcyclohexyl) 2-pyridin-2-ylacetate.
| Compound Name | (2-methylcyclohexyl) 2-pyridin-2-ylacetate |
|---|---|
| PubChem CID | 15055566 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2-methylcyclohexyl) 2-pyridin-2-ylacetate |
| SMILES | CC1CCCCC1OC(=O)Cc1ccccn1 |
| InChI | InChI=1S/C14H19NO2/c1-11-6-2-3-8-13(11)17-14(16)10-12-7-4-5-9-15-12/h4-5,7,9,11,13H,2-3,6,8,10H2,1H3 |
| InChIKey | TZKFDTGERCIPMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |