About (2-methylcyclohexyl) propanoate
(2-methylcyclohexyl) propanoate (PubChem CID 546179) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (2-methylcyclohexyl) propanoate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) propanoate |
| PubChem CID | 546179 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2-methylcyclohexyl) propanoate |
| SMILES | CCC(=O)OC1CCCCC1C |
| InChI | InChI=1S/C10H18O2/c1-3-10(11)12-9-7-5-4-6-8(9)2/h8-9H,3-7H2,1-2H3 |
| InChIKey | ROGMVGDZNVAXSR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-methylcyclohexyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) propanoate?
The IUPAC name of (2-methylcyclohexyl) propanoate (CID 546179) is (2-methylcyclohexyl) propanoate.
What is the SMILES notation for (2-methylcyclohexyl) propanoate?
The canonical SMILES for (2-methylcyclohexyl) propanoate is CCC(=O)OC1CCCCC1C.
What is the InChIKey of (2-methylcyclohexyl) propanoate?
The InChIKey is ROGMVGDZNVAXSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-10(11)12-9-7-5-4-6-8(9)2/h8-9H,3-7H2,1-2H3.
What are the key properties of (2-methylcyclohexyl) propanoate?
(2-methylcyclohexyl) propanoate has a molecular weight of 170.25 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) propanoate is sourced from PubChem (CID 546179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).