About (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole
(2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole (PubChem CID 174963764) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole.
Molecular Properties
| Compound Name | (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole |
| PubChem CID | 174963764 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole |
| SMILES | O=C(Cc1ccccn1)OC(=O)Cc1ccccn1.c1cc[nH]c1 |
| InChI | InChI=1S/C14H12N2O3.C4H5N/c17-13(9-11-5-1-3-7-15-11)19-14(18)10-12-6-2-4-8-16-12;1-2-4-5-3-1/h1-8H,9-10H2;1-5H |
| InChIKey | NGNSUDMQRCKGGB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole?
The IUPAC name of (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole (CID 174963764) is (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole.
What is the SMILES notation for (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole?
The canonical SMILES for (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole is O=C(Cc1ccccn1)OC(=O)Cc1ccccn1.c1cc[nH]c1.
What is the InChIKey of (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole?
The InChIKey is NGNSUDMQRCKGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3.C4H5N/c17-13(9-11-5-1-3-7-15-11)19-14(18)10-12-6-2-4-8-16-12;1-2-4-5-3-1/h1-8H,9-10H2;1-5H.
What are the key properties of (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole?
(2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole has a molecular weight of 323.35 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyridin-2-ylacetyl) 2-pyridin-2-ylacetate;1H-pyrrole is sourced from PubChem (CID 174963764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).