About 1H-imidazole;2-pyridin-2-ylacetamide
1H-imidazole;2-pyridin-2-ylacetamide (PubChem CID 68897085) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1H-imidazole;2-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | 1H-imidazole;2-pyridin-2-ylacetamide |
| PubChem CID | 68897085 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1H-imidazole;2-pyridin-2-ylacetamide |
| SMILES | NC(=O)Cc1ccccn1.c1c[nH]cn1 |
| InChI | InChI=1S/C7H8N2O.C3H4N2/c8-7(10)5-6-3-1-2-4-9-6;1-2-5-3-4-1/h1-4H,5H2,(H2,8,10);1-3H,(H,4,5) |
| InChIKey | BRLXYWRQMNQPDO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazole;2-pyridin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;2-pyridin-2-ylacetamide?
The IUPAC name of 1H-imidazole;2-pyridin-2-ylacetamide (CID 68897085) is 1H-imidazole;2-pyridin-2-ylacetamide.
What is the SMILES notation for 1H-imidazole;2-pyridin-2-ylacetamide?
The canonical SMILES for 1H-imidazole;2-pyridin-2-ylacetamide is NC(=O)Cc1ccccn1.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;2-pyridin-2-ylacetamide?
The InChIKey is BRLXYWRQMNQPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C3H4N2/c8-7(10)5-6-3-1-2-4-9-6;1-2-5-3-4-1/h1-4H,5H2,(H2,8,10);1-3H,(H,4,5).
What are the key properties of 1H-imidazole;2-pyridin-2-ylacetamide?
1H-imidazole;2-pyridin-2-ylacetamide has a molecular weight of 204.23 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;2-pyridin-2-ylacetamide is sourced from PubChem (CID 68897085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).