About molecular hydrogen;2-pyridin-2-ylacetamide
molecular hydrogen;2-pyridin-2-ylacetamide (PubChem CID 145224814) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is molecular hydrogen;2-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | molecular hydrogen;2-pyridin-2-ylacetamide |
| PubChem CID | 145224814 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | molecular hydrogen;2-pyridin-2-ylacetamide |
| SMILES | NC(=O)Cc1ccccn1.[H][H] |
| InChI | InChI=1S/C7H8N2O.H2/c8-7(10)5-6-3-1-2-4-9-6;/h1-4H,5H2,(H2,8,10);1H |
| InChIKey | XVLFXSSHANYYNA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze molecular hydrogen;2-pyridin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;2-pyridin-2-ylacetamide?
The IUPAC name of molecular hydrogen;2-pyridin-2-ylacetamide (CID 145224814) is molecular hydrogen;2-pyridin-2-ylacetamide.
What is the SMILES notation for molecular hydrogen;2-pyridin-2-ylacetamide?
The canonical SMILES for molecular hydrogen;2-pyridin-2-ylacetamide is NC(=O)Cc1ccccn1.[H][H].
What is the InChIKey of molecular hydrogen;2-pyridin-2-ylacetamide?
The InChIKey is XVLFXSSHANYYNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.H2/c8-7(10)5-6-3-1-2-4-9-6;/h1-4H,5H2,(H2,8,10);1H.
What are the key properties of molecular hydrogen;2-pyridin-2-ylacetamide?
molecular hydrogen;2-pyridin-2-ylacetamide has a molecular weight of 138.17 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2-pyridin-2-ylacetamide is sourced from PubChem (CID 145224814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).