molecular hydrogen;2-pyridin-2-ylacetamide

C7H10N2O — CID 145224814

IUPACmolecular hydrogen;2-pyridin-2-ylacetamide
SMILESNC(=O)Cc1ccccn1.[H][H]
InChIInChI=1S/C7H8N2O.H2/c8-7(10)5-6-3-1-2-4-9-6;/h1-4H,5H2,(H2,8,10);1H
InChIKeyXVLFXSSHANYYNA-UHFFFAOYSA-N
MW138.17 g/mol
LogP0.36
Rot. Bonds2

About molecular hydrogen;2-pyridin-2-ylacetamide

molecular hydrogen;2-pyridin-2-ylacetamide (PubChem CID 145224814) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is molecular hydrogen;2-pyridin-2-ylacetamide.

Molecular Properties

Compound Namemolecular hydrogen;2-pyridin-2-ylacetamide
PubChem CID145224814
Molecular FormulaC7H10N2O
Molecular Weight138.17 g/mol
Exact Mass138.08
IUPAC Namemolecular hydrogen;2-pyridin-2-ylacetamide
SMILESNC(=O)Cc1ccccn1.[H][H]
InChIInChI=1S/C7H8N2O.H2/c8-7(10)5-6-3-1-2-4-9-6;/h1-4H,5H2,(H2,8,10);1H
InChIKeyXVLFXSSHANYYNA-UHFFFAOYSA-N
XLogP0.36
TPSA55.98 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.17
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;2-pyridin-2-ylacetamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;2-pyridin-2-ylacetamide?
The IUPAC name of molecular hydrogen;2-pyridin-2-ylacetamide (CID 145224814) is molecular hydrogen;2-pyridin-2-ylacetamide.
What is the SMILES notation for molecular hydrogen;2-pyridin-2-ylacetamide?
The canonical SMILES for molecular hydrogen;2-pyridin-2-ylacetamide is NC(=O)Cc1ccccn1.[H][H].
What is the InChIKey of molecular hydrogen;2-pyridin-2-ylacetamide?
The InChIKey is XVLFXSSHANYYNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.H2/c8-7(10)5-6-3-1-2-4-9-6;/h1-4H,5H2,(H2,8,10);1H.
What are the key properties of molecular hydrogen;2-pyridin-2-ylacetamide?
molecular hydrogen;2-pyridin-2-ylacetamide has a molecular weight of 138.17 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2-pyridin-2-ylacetamide is sourced from PubChem (CID 145224814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).