C16H16N2O2 — CID 103993279
1,2,3,4-tetrahydronaphthalen-1-yl 3-aminopyridine-2-carboxylate (PubChem CID 103993279) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl 3-aminopyridine-2-carboxylate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl 3-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 103993279 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl 3-aminopyridine-2-carboxylate |
| SMILES | Nc1cccnc1C(=O)OC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H16N2O2/c17-13-8-4-10-18-15(13)16(19)20-14-9-3-6-11-5-1-2-7-12(11)14/h1-2,4-5,7-8,10,14H,3,6,9,17H2 |
| InChIKey | VLZFYKRAAFFAOY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |