C16H14BrNO2 — CID 66462388
1,2,3,4-tetrahydronaphthalen-1-yl 6-bromopyridine-3-carboxylate (PubChem CID 66462388) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl 6-bromopyridine-3-carboxylate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl 6-bromopyridine-3-carboxylate |
|---|---|
| PubChem CID | 66462388 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl 6-bromopyridine-3-carboxylate |
| SMILES | O=C(OC1CCCc2ccccc21)c1ccc(Br)nc1 |
| InChI | InChI=1S/C16H14BrNO2/c17-15-9-8-12(10-18-15)16(19)20-14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14H,3,5,7H2 |
| InChIKey | VRNHXNKZMUUMRT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|