C13H14O2 — CID 21316429
1,2,3,4-tetrahydronaphthalen-1-yl prop-2-enoate (PubChem CID 21316429) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl prop-2-enoate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl prop-2-enoate |
|---|---|
| PubChem CID | 21316429 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1CCCc2ccccc21 |
| InChI | InChI=1S/C13H14O2/c1-2-13(14)15-12-9-5-7-10-6-3-4-8-11(10)12/h2-4,6,8,12H,1,5,7,9H2 |
| InChIKey | STIQQSQWWUKLJQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|