C11H13NO — CID 174418938
N-(1,2,3,4-tetrahydronaphthalen-1-yloxy)methanimine (PubChem CID 174418938) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yloxy)methanimine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yloxy)methanimine |
|---|---|
| PubChem CID | 174418938 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yloxy)methanimine |
| SMILES | C=NOC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H13NO/c1-12-13-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,11H,1,4,6,8H2 |
| InChIKey | FARCCGOKANRQCF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|