C10H11Si — CID 59863888
CID 59863888 (PubChem CID 59863888) has the molecular formula C10H11Si and a molecular weight of 159.28 g/mol.
| Compound Name | CID 59863888 |
|---|---|
| PubChem CID | 59863888 |
| Molecular Formula | C10H11Si |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | — |
| SMILES | [Si]C1CCCc2ccccc21 |
| InChI | InChI=1S/C10H11Si/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2 |
| InChIKey | AARQFCGBICJBGA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|