C14H19N — CID 122364481
1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine (PubChem CID 122364481) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine.
| Compound Name | 1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine |
|---|---|
| PubChem CID | 122364481 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine |
| SMILES | c1ccc2c(c1)CCC[C@H]2N1CCCC1 |
| InChI | InChI=1S/C14H19N/c1-2-8-13-12(6-1)7-5-9-14(13)15-10-3-4-11-15/h1-2,6,8,14H,3-5,7,9-11H2/t14-/m1/s1 |
| InChIKey | ZITWPCRUVMZEJN-CQSZACIVSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |