C15H21N — CID 141000985
1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine (PubChem CID 141000985) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine.
| Compound Name | 1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine |
|---|---|
| PubChem CID | 141000985 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine |
| SMILES | c1ccc2c(c1)CCC[C@H]2N1CCCCC1 |
| InChI | InChI=1S/C15H21N/c1-4-11-16(12-5-1)15-10-6-8-13-7-2-3-9-14(13)15/h2-3,7,9,15H,1,4-6,8,10-12H2/t15-/m1/s1 |
| InChIKey | QECRCCXOLSHZLX-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |