C11H12FNO — CID 90147743
N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl fluoride (PubChem CID 90147743) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl fluoride.
| Compound Name | N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl fluoride |
|---|---|
| PubChem CID | 90147743 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl fluoride |
| SMILES | O=C(F)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C11H12FNO/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2,(H,13,14)/t10-/m1/s1 |
| InChIKey | APMZTOZJKPJRMR-SNVBAGLBSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|